C11H18N2O2 — CID 54136300
1,3-diethyl-5,5-dimethyl-2-methylidene-1,3-diazinane-4,6-dione (PubChem CID 54136300) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 1,3-diethyl-5,5-dimethyl-2-methylidene-1,3-diazinane-4,6-dione.
| Compound Name | 1,3-diethyl-5,5-dimethyl-2-methylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 54136300 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | 1,3-diethyl-5,5-dimethyl-2-methylidene-1,3-diazinane-4,6-dione |
| SMILES | C=C1N(CC)C(=O)C(C)(C)C(=O)N1CC |
| InChI | InChI=1S/C11H18N2O2/c1-6-12-8(3)13(7-2)10(15)11(4,5)9(12)14/h3,6-7H2,1-2,4-5H3 |
| InChIKey | NXXZVPTZIHHRDZ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|