C27H36BrN4O6P — CID 54136668
(6-amino-5-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid (PubChem CID 54136668) has the molecular formula C27H36BrN4O6P and a molecular weight of 623.49 g/mol. Its IUPAC name is (6-amino-5-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid.
| Compound Name | (6-amino-5-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
|---|---|
| PubChem CID | 54136668 |
| Molecular Formula | C27H36BrN4O6P |
| Molecular Weight | 623.49 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | (6-amino-5-bromo-1,3-dioxobenzo[de]isoquinolin-2-yl)methyl-[4-methyl-2-[[(2S)-4-methyl-1-(methylamino)-1-oxopentan-2-yl]carbamoyl]pentyl]phosphinic acid |
| SMILES | CNC(=O)[C@H](CC(C)C)NC(=O)C(CC(C)C)CP(=O)(O)CN1C(=O)c2cccc3c(N)c(Br)cc(c23)C1=O |
| InChI | InChI=1S/C27H36BrN4O6P/c1-14(2)9-16(24(33)31-21(10-15(3)4)25(34)30-5)12-39(37,38)13-32-26(35)18-8-6-7-17-22(18)19(27(32)36)11-20(28)23(17)29/h6-8,11,14-16,21H,9-10,12-13,29H2,1-5H3,(H,30,34)(H,31,33)(H,37,38)/t16?,21-/m0/s1 |
| InChIKey | NYEVJEJNXBMVGM-MRNPHLECSA-N |
| XLogP | 3.95 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.49 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|