C21H23ClN2S — CID 54136757
8-chloro-6-propyl-5-(2-propylphenyl)-1,3-dihydro-1,4-benzodiazepine-2-thione (PubChem CID 54136757) has the molecular formula C21H23ClN2S and a molecular weight of 370.95 g/mol. Its IUPAC name is 8-chloro-6-propyl-5-(2-propylphenyl)-1,3-dihydro-1,4-benzodiazepine-2-thione.
| Compound Name | 8-chloro-6-propyl-5-(2-propylphenyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
|---|---|
| PubChem CID | 54136757 |
| Molecular Formula | C21H23ClN2S |
| Molecular Weight | 370.95 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 8-chloro-6-propyl-5-(2-propylphenyl)-1,3-dihydro-1,4-benzodiazepine-2-thione |
| SMILES | CCCc1ccccc1C1=NCC(=S)Nc2cc(Cl)cc(CCC)c21 |
| InChI | InChI=1S/C21H23ClN2S/c1-3-7-14-9-5-6-10-17(14)21-20-15(8-4-2)11-16(22)12-18(20)24-19(25)13-23-21/h5-6,9-12H,3-4,7-8,13H2,1-2H3,(H,24,25) |
| InChIKey | NYGLPHSMQMKSMB-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.95 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|