About methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate
methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate (PubChem CID 54136983) has the molecular formula C8H10N4O3
and a molecular weight of 210.19 g/mol. Its IUPAC name is methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate |
| PubChem CID | 54136983 |
| Molecular Formula | C8H10N4O3 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate |
| SMILES | COC(=O)C1CC(n2cncn2)C(=O)N1 |
| InChI | InChI=1S/C8H10N4O3/c1-15-8(14)5-2-6(7(13)11-5)12-4-9-3-10-12/h3-6H,2H2,1H3,(H,11,13) |
| InChIKey | NYKKOQNTUOMLAA-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate (CID 54136983) is methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate is COC(=O)C1CC(n2cncn2)C(=O)N1.
What is the InChIKey of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
The InChIKey is NYKKOQNTUOMLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c1-15-8(14)5-2-6(7(13)11-5)12-4-9-3-10-12/h3-6H,2H2,1H3,(H,11,13).
What are the key properties of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate has a molecular weight of 210.19 g/mol, XLogP of -1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 54136983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).