methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate

C8H10N4O3 — CID 54136983

IUPACmethyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate
SMILESCOC(=O)C1CC(n2cncn2)C(=O)N1
InChIInChI=1S/C8H10N4O3/c1-15-8(14)5-2-6(7(13)11-5)12-4-9-3-10-12/h3-6H,2H2,1H3,(H,11,13)
InChIKeyNYKKOQNTUOMLAA-UHFFFAOYSA-N
MW210.19 g/mol
LogP-1.12
Rot. Bonds2

About methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate

methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate (PubChem CID 54136983) has the molecular formula C8H10N4O3 and a molecular weight of 210.19 g/mol. Its IUPAC name is methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate.

Molecular Properties

Compound Namemethyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate
PubChem CID54136983
Molecular FormulaC8H10N4O3
Molecular Weight210.19 g/mol
Exact Mass210.08
IUPAC Namemethyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate
SMILESCOC(=O)C1CC(n2cncn2)C(=O)N1
InChIInChI=1S/C8H10N4O3/c1-15-8(14)5-2-6(7(13)11-5)12-4-9-3-10-12/h3-6H,2H2,1H3,(H,11,13)
InChIKeyNYKKOQNTUOMLAA-UHFFFAOYSA-N
XLogP-1.12
TPSA86.11 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds2
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.19
LogP ≤ 5-1.12
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
The IUPAC name of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate (CID 54136983) is methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate.
What is the SMILES notation for methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
The canonical SMILES for methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate is COC(=O)C1CC(n2cncn2)C(=O)N1.
What is the InChIKey of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
The InChIKey is NYKKOQNTUOMLAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O3/c1-15-8(14)5-2-6(7(13)11-5)12-4-9-3-10-12/h3-6H,2H2,1H3,(H,11,13).
What are the key properties of methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate?
methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate has a molecular weight of 210.19 g/mol, XLogP of -1.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-oxo-4-(1,2,4-triazol-1-yl)pyrrolidine-2-carboxylate is sourced from PubChem (CID 54136983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).