C31H48N2O — CID 54137469
5-[(4S)-4-methylhexyl]-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]pyrimidine (PubChem CID 54137469) has the molecular formula C31H48N2O and a molecular weight of 464.74 g/mol. Its IUPAC name is 5-[(4S)-4-methylhexyl]-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]pyrimidine.
| Compound Name | 5-[(4S)-4-methylhexyl]-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]pyrimidine |
|---|---|
| PubChem CID | 54137469 |
| Molecular Formula | C31H48N2O |
| Molecular Weight | 464.74 g/mol |
| Exact Mass | 464.38 |
| IUPAC Name | 5-[(4S)-4-methylhexyl]-2-[4-[3-(4-pentylcyclohexyl)propoxy]phenyl]pyrimidine |
| SMILES | CCCCCC1CCC(CCCOc2ccc(-c3ncc(CCC[C@@H](C)CC)cn3)cc2)CC1 |
| InChI | InChI=1S/C31H48N2O/c1-4-6-7-11-26-14-16-27(17-15-26)13-9-22-34-30-20-18-29(19-21-30)31-32-23-28(24-33-31)12-8-10-25(3)5-2/h18-21,23-27H,4-17,22H2,1-3H3/t25-,26?,27?/m0/s1 |
| InChIKey | NYSNPCJRRLVTNI-JRFCFUNGSA-N |
| XLogP | 9.06 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.74 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|