About sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate
sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate (PubChem CID 541384) has the molecular formula C15H17I3NNaO3
and a molecular weight of 663.01 g/mol. Its IUPAC name is sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate.
Molecular Properties
| Compound Name | sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate |
| PubChem CID | 541384 |
| Molecular Formula | C15H17I3NNaO3 |
| Molecular Weight | 663.01 g/mol |
| Exact Mass | 662.82 |
| IUPAC Name | sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate |
| SMILES | CCCC(=O)Nc1c(I)cc(I)c(CC(CC)C(=O)[O-])c1I.[Na+] |
| InChI | InChI=1S/C15H18I3NO3.Na/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22;/h7-8H,3-6H2,1-2H3,(H,19,20)(H,21,22);/q;+1/p-1 |
| InChIKey | KTVKGXZZBQCBGD-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 663.01 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate?
The IUPAC name of sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate (CID 541384) is sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate.
What is the SMILES notation for sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate?
The canonical SMILES for sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate is CCCC(=O)Nc1c(I)cc(I)c(CC(CC)C(=O)[O-])c1I.[Na+].
What is the InChIKey of sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate?
The InChIKey is KTVKGXZZBQCBGD-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H18I3NO3.Na/c1-3-5-12(20)19-14-11(17)7-10(16)9(13(14)18)6-8(4-2)15(21)22;/h7-8H,3-6H2,1-2H3,(H,19,20)(H,21,22);/q;+1/p-1.
What are the key properties of sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate?
sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate has a molecular weight of 663.01 g/mol, XLogP of 0.56, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[[3-(butanoylamino)-2,4,6-triiodophenyl]methyl]butanoate is sourced from PubChem (CID 541384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).