4-diazocyclohexa-1,5-diene-1-carboxylic acid

C7H6N2O2 — CID 54138563

IUPAC4-diazocyclohexa-1,5-diene-1-carboxylic acid
SMILES[N-]=[N+]=C1C=CC(C(=O)O)=CC1
InChIInChI=1S/C7H6N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-3H,4H2,(H,10,11)
InChIKeyNZLGGJHRCALCCD-UHFFFAOYSA-N
MW150.14 g/mol
LogP0.63
Rot. Bonds1

About 4-diazocyclohexa-1,5-diene-1-carboxylic acid

4-diazocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 54138563) has the molecular formula C7H6N2O2 and a molecular weight of 150.14 g/mol. Its IUPAC name is 4-diazocyclohexa-1,5-diene-1-carboxylic acid.

Molecular Properties

Compound Name4-diazocyclohexa-1,5-diene-1-carboxylic acid
PubChem CID54138563
Molecular FormulaC7H6N2O2
Molecular Weight150.14 g/mol
Exact Mass150.04
IUPAC Name4-diazocyclohexa-1,5-diene-1-carboxylic acid
SMILES[N-]=[N+]=C1C=CC(C(=O)O)=CC1
InChIInChI=1S/C7H6N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-3H,4H2,(H,10,11)
InChIKeyNZLGGJHRCALCCD-UHFFFAOYSA-N
XLogP0.63
TPSA73.70 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500150.14
LogP ≤ 50.63
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}

Analyze 4-diazocyclohexa-1,5-diene-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-diazocyclohexa-1,5-diene-1-carboxylic acid?
The IUPAC name of 4-diazocyclohexa-1,5-diene-1-carboxylic acid (CID 54138563) is 4-diazocyclohexa-1,5-diene-1-carboxylic acid.
What is the SMILES notation for 4-diazocyclohexa-1,5-diene-1-carboxylic acid?
The canonical SMILES for 4-diazocyclohexa-1,5-diene-1-carboxylic acid is [N-]=[N+]=C1C=CC(C(=O)O)=CC1.
What is the InChIKey of 4-diazocyclohexa-1,5-diene-1-carboxylic acid?
The InChIKey is NZLGGJHRCALCCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O2/c8-9-6-3-1-5(2-4-6)7(10)11/h1-3H,4H2,(H,10,11).
What are the key properties of 4-diazocyclohexa-1,5-diene-1-carboxylic acid?
4-diazocyclohexa-1,5-diene-1-carboxylic acid has a molecular weight of 150.14 g/mol, XLogP of 0.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-diazocyclohexa-1,5-diene-1-carboxylic acid is sourced from PubChem (CID 54138563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).