About ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate
ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate (PubChem CID 54138903) has the molecular formula C12H22O3S2
and a molecular weight of 278.44 g/mol. Its IUPAC name is ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate.
Molecular Properties
| Compound Name | ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate |
| PubChem CID | 54138903 |
| Molecular Formula | C12H22O3S2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate |
| SMILES | CCOC(=O)C(SC(C)C)(SC(C)C)C(C)=O |
| InChI | InChI=1S/C12H22O3S2/c1-7-15-11(14)12(10(6)13,16-8(2)3)17-9(4)5/h8-9H,7H2,1-6H3 |
| InChIKey | NZRRWSHKOZWMHT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate?
The IUPAC name of ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate (CID 54138903) is ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate.
What is the SMILES notation for ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate?
The canonical SMILES for ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate is CCOC(=O)C(SC(C)C)(SC(C)C)C(C)=O.
What is the InChIKey of ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate?
The InChIKey is NZRRWSHKOZWMHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S2/c1-7-15-11(14)12(10(6)13,16-8(2)3)17-9(4)5/h8-9H,7H2,1-6H3.
What are the key properties of ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate?
ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate has a molecular weight of 278.44 g/mol, XLogP of 3.12, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-oxo-2,2-bis(propan-2-ylsulfanyl)butanoate is sourced from PubChem (CID 54138903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).