C19H29NO2 — CID 54139029
N-[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-7-methyloct-4-enamide (PubChem CID 54139029) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-7-methyloct-4-enamide.
| Compound Name | N-[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-7-methyloct-4-enamide |
|---|---|
| PubChem CID | 54139029 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-[(2R,3R)-3-hydroxy-2-methyl-3-phenylpropyl]-7-methyloct-4-enamide |
| SMILES | CC(C)CC=CCCC(=O)NC[C@@H](C)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-15(2)10-6-4-9-13-18(21)20-14-16(3)19(22)17-11-7-5-8-12-17/h4-8,11-12,15-16,19,22H,9-10,13-14H2,1-3H3,(H,20,21)/t16-,19-/m1/s1 |
| InChIKey | NZTPMCAITDYFLX-VQIMIIECSA-N |
| XLogP | 3.85 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|