C16H16N2O7S2 — CID 54139904
3-acetamido-4-(2-acetamido-4-sulfinophenoxy)benzenesulfinic acid (PubChem CID 54139904) has the molecular formula C16H16N2O7S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-acetamido-4-(2-acetamido-4-sulfinophenoxy)benzenesulfinic acid.
| Compound Name | 3-acetamido-4-(2-acetamido-4-sulfinophenoxy)benzenesulfinic acid |
|---|---|
| PubChem CID | 54139904 |
| Molecular Formula | C16H16N2O7S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | 3-acetamido-4-(2-acetamido-4-sulfinophenoxy)benzenesulfinic acid |
| SMILES | CC(=O)Nc1cc(S(=O)O)ccc1Oc1ccc(S(=O)O)cc1NC(C)=O |
| InChI | InChI=1S/C16H16N2O7S2/c1-9(19)17-13-7-11(26(21)22)3-5-15(13)25-16-6-4-12(27(23)24)8-14(16)18-10(2)20/h3-8H,1-2H3,(H,17,19)(H,18,20)(H,21,22)(H,23,24) |
| InChIKey | OAJCVPFMGCQJME-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 142.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|