About tetrakis(hept-2-enyl) silicate
tetrakis(hept-2-enyl) silicate (PubChem CID 54139906) has the molecular formula C28H52O4Si
and a molecular weight of 480.81 g/mol. Its IUPAC name is tetrakis(hept-2-enyl) silicate.
Molecular Properties
| Compound Name | tetrakis(hept-2-enyl) silicate |
| PubChem CID | 54139906 |
| Molecular Formula | C28H52O4Si |
| Molecular Weight | 480.81 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | tetrakis(hept-2-enyl) silicate |
| SMILES | CCCCC=CCO[Si](OCC=CCCCC)(OCC=CCCCC)OCC=CCCCC |
| InChI | InChI=1S/C28H52O4Si/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4/h17-24H,5-16,25-28H2,1-4H3 |
| InChIKey | OAJDERNWQKMWIN-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 480.81 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tetrakis(hept-2-enyl) silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tetrakis(hept-2-enyl) silicate?
The IUPAC name of tetrakis(hept-2-enyl) silicate (CID 54139906) is tetrakis(hept-2-enyl) silicate.
What is the SMILES notation for tetrakis(hept-2-enyl) silicate?
The canonical SMILES for tetrakis(hept-2-enyl) silicate is CCCCC=CCO[Si](OCC=CCCCC)(OCC=CCCCC)OCC=CCCCC.
What is the InChIKey of tetrakis(hept-2-enyl) silicate?
The InChIKey is OAJDERNWQKMWIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H52O4Si/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4/h17-24H,5-16,25-28H2,1-4H3.
What are the key properties of tetrakis(hept-2-enyl) silicate?
tetrakis(hept-2-enyl) silicate has a molecular weight of 480.81 g/mol, XLogP of 8.47, 24 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tetrakis(hept-2-enyl) silicate is sourced from PubChem (CID 54139906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).