C25H33NO2 — CID 54139953
(3aS,3bS,4S,5aR,9aR,9bS,11aS)-4-[hydroxy(phenyl)methyl]-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one (PubChem CID 54139953) has the molecular formula C25H33NO2 and a molecular weight of 379.54 g/mol. Its IUPAC name is (3aS,3bS,4S,5aR,9aR,9bS,11aS)-4-[hydroxy(phenyl)methyl]-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (3aS,3bS,4S,5aR,9aR,9bS,11aS)-4-[hydroxy(phenyl)methyl]-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 54139953 |
| Molecular Formula | C25H33NO2 |
| Molecular Weight | 379.54 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | (3aS,3bS,4S,5aR,9aR,9bS,11aS)-4-[hydroxy(phenyl)methyl]-9a,11a-dimethyl-1,2,3,3a,3b,4,5,5a,6,9b,10,11-dodecahydroindeno[5,4-f]quinolin-7-one |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1[C@@H](C(O)c3ccccc3)C[C@H]3NC(=O)C=C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C25H33NO2/c1-24-12-6-9-18(24)22-17(23(28)16-7-4-3-5-8-16)15-20-25(2,19(22)10-13-24)14-11-21(27)26-20/h3-5,7-8,11,14,17-20,22-23,28H,6,9-10,12-13,15H2,1-2H3,(H,26,27)/t17-,18-,19-,20+,22-,23?,24-,25+/m0/s1 |
| InChIKey | OAKAGWBUYCXGQB-XFBIMXQZSA-N |
| XLogP | 4.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.54 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |