C34H42N2O7S2 — CID 54140044
5-[2-tert-butyl-4-(dimethylsulfamoylamino)-5-methylphenyl]sulfanyl-2,2-bis[2-(4-hydroxyphenyl)ethyl]-4,6-dioxooxane (PubChem CID 54140044) has the molecular formula C34H42N2O7S2 and a molecular weight of 654.85 g/mol. Its IUPAC name is 5-[2-tert-butyl-4-(dimethylsulfamoylamino)-5-methylphenyl]sulfanyl-2,2-bis[2-(4-hydroxyphenyl)ethyl]-4,6-dioxooxane.
| Compound Name | 5-[2-tert-butyl-4-(dimethylsulfamoylamino)-5-methylphenyl]sulfanyl-2,2-bis[2-(4-hydroxyphenyl)ethyl]-4,6-dioxooxane |
|---|---|
| PubChem CID | 54140044 |
| Molecular Formula | C34H42N2O7S2 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.24 |
| IUPAC Name | 5-[2-tert-butyl-4-(dimethylsulfamoylamino)-5-methylphenyl]sulfanyl-2,2-bis[2-(4-hydroxyphenyl)ethyl]-4,6-dioxooxane |
| SMILES | Cc1cc(SC2C(=O)CC(CCc3ccc(O)cc3)(CCc3ccc(O)cc3)OC2=O)c(C(C)(C)C)cc1NS(=O)(=O)N(C)C |
| InChI | InChI=1S/C34H42N2O7S2/c1-22-19-30(27(33(2,3)4)20-28(22)35-45(41,42)36(5)6)44-31-29(39)21-34(43-32(31)40,17-15-23-7-11-25(37)12-8-23)18-16-24-9-13-26(38)14-10-24/h7-14,19-20,31,35,37-38H,15-18,21H2,1-6H3 |
| InChIKey | OALNFYZCPJGKOK-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 133.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|