About [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane
[ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane (PubChem CID 54140106) has the molecular formula C8H17N3OSi
and a molecular weight of 199.33 g/mol. Its IUPAC name is [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane.
Molecular Properties
| Compound Name | [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane |
| PubChem CID | 54140106 |
| Molecular Formula | C8H17N3OSi |
| Molecular Weight | 199.33 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane |
| SMILES | CCOC(n1cncn1)[Si](C)(C)C |
| InChI | InChI=1S/C8H17N3OSi/c1-5-12-8(13(2,3)4)11-7-9-6-10-11/h6-8H,5H2,1-4H3 |
| InChIKey | OAMHTPKKNRSRIL-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane?
The IUPAC name of [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane (CID 54140106) is [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane.
What is the SMILES notation for [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane?
The canonical SMILES for [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane is CCOC(n1cncn1)[Si](C)(C)C.
What is the InChIKey of [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane?
The InChIKey is OAMHTPKKNRSRIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17N3OSi/c1-5-12-8(13(2,3)4)11-7-9-6-10-11/h6-8H,5H2,1-4H3.
What are the key properties of [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane?
[ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane has a molecular weight of 199.33 g/mol, XLogP of 1.69, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [ethoxy(1,2,4-triazol-1-yl)methyl]-trimethylsilane is sourced from PubChem (CID 54140106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).