C24H33NO7S — CID 54140527
[3-[[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid (PubChem CID 54140527) has the molecular formula C24H33NO7S and a molecular weight of 479.60 g/mol. Its IUPAC name is [3-[[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid.
| Compound Name | [3-[[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
|---|---|
| PubChem CID | 54140527 |
| Molecular Formula | C24H33NO7S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | [3-[[4-(2-hydroxy-3-morpholin-4-ylpropoxy)phenyl]methylidene]-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid |
| SMILES | CC1(C)C2CCC1(CS(=O)(=O)O)C(=O)C2=Cc1ccc(OCC(O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C24H33NO7S/c1-23(2)21-7-8-24(23,16-33(28,29)30)22(27)20(21)13-17-3-5-19(6-4-17)32-15-18(26)14-25-9-11-31-12-10-25/h3-6,13,18,21,26H,7-12,14-16H2,1-2H3,(H,28,29,30) |
| InChIKey | OATRZGZPEGFSEE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|