C11H12F12N2O — CID 54140561
1,3-bis(2,2,3,4,4,4-hexafluorobutyl)-1,3-dimethylurea (PubChem CID 54140561) has the molecular formula C11H12F12N2O and a molecular weight of 416.21 g/mol. Its IUPAC name is 1,3-bis(2,2,3,4,4,4-hexafluorobutyl)-1,3-dimethylurea.
| Compound Name | 1,3-bis(2,2,3,4,4,4-hexafluorobutyl)-1,3-dimethylurea |
|---|---|
| PubChem CID | 54140561 |
| Molecular Formula | C11H12F12N2O |
| Molecular Weight | 416.21 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | 1,3-bis(2,2,3,4,4,4-hexafluorobutyl)-1,3-dimethylurea |
| SMILES | CN(CC(F)(F)C(F)C(F)(F)F)C(=O)N(C)CC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C11H12F12N2O/c1-24(3-8(14,15)5(12)10(18,19)20)7(26)25(2)4-9(16,17)6(13)11(21,22)23/h5-6H,3-4H2,1-2H3 |
| InChIKey | OAUJQODJXYFGEO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.21 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |