About ethenyl N-propylcarbamate
ethenyl N-propylcarbamate (PubChem CID 54140582) has the molecular formula C6H11NO2
and a molecular weight of 129.16 g/mol. Its IUPAC name is ethenyl N-propylcarbamate.
Molecular Properties
| Compound Name | ethenyl N-propylcarbamate |
| PubChem CID | 54140582 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | ethenyl N-propylcarbamate |
| SMILES | C=COC(=O)NCCC |
| InChI | InChI=1S/C6H11NO2/c1-3-5-7-6(8)9-4-2/h4H,2-3,5H2,1H3,(H,7,8) |
| InChIKey | OAUUVRKMMQNZNJ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze ethenyl N-propylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl N-propylcarbamate?
The IUPAC name of ethenyl N-propylcarbamate (CID 54140582) is ethenyl N-propylcarbamate.
What is the SMILES notation for ethenyl N-propylcarbamate?
The canonical SMILES for ethenyl N-propylcarbamate is C=COC(=O)NCCC.
What is the InChIKey of ethenyl N-propylcarbamate?
The InChIKey is OAUUVRKMMQNZNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2/c1-3-5-7-6(8)9-4-2/h4H,2-3,5H2,1H3,(H,7,8).
What are the key properties of ethenyl N-propylcarbamate?
ethenyl N-propylcarbamate has a molecular weight of 129.16 g/mol, XLogP of 1.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl N-propylcarbamate is sourced from PubChem (CID 54140582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).