C19H31NO3 — CID 54140826
4-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butanoic acid (PubChem CID 54140826) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 4-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butanoic acid.
| Compound Name | 4-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butanoic acid |
|---|---|
| PubChem CID | 54140826 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 4-oxo-4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)butanoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCNC(=O)CCC(=O)O |
| InChI | InChI=1S/C19H31NO3/c1-15(2)7-5-8-16(3)9-6-10-17(4)13-14-20-18(21)11-12-19(22)23/h7,9,13H,5-6,8,10-12,14H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | OAYWXVWYPIATQJ-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|