C28H27NO4 — CID 54141147
2-[6-[3-(benzhydrylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid (PubChem CID 54141147) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 2-[6-[3-(benzhydrylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid.
| Compound Name | 2-[6-[3-(benzhydrylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 54141147 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 2-[6-[3-(benzhydrylamino)-3-oxopropyl]-5,6,7,8-tetrahydronaphthalen-1-yl]-2-oxoacetic acid |
| SMILES | O=C(CCC1CCc2c(cccc2C(=O)C(=O)O)C1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H27NO4/c30-25(29-26(20-8-3-1-4-9-20)21-10-5-2-6-11-21)17-15-19-14-16-23-22(18-19)12-7-13-24(23)27(31)28(32)33/h1-13,19,26H,14-18H2,(H,29,30)(H,32,33) |
| InChIKey | OBEOXELYTYGMBY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|