C22H35N3O2Si — CID 54141268
[(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methylimidazol-4-yl)methanol (PubChem CID 54141268) has the molecular formula C22H35N3O2Si and a molecular weight of 401.63 g/mol. Its IUPAC name is [(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methylimidazol-4-yl)methanol.
| Compound Name | [(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methylimidazol-4-yl)methanol |
|---|---|
| PubChem CID | 54141268 |
| Molecular Formula | C22H35N3O2Si |
| Molecular Weight | 401.63 g/mol |
| Exact Mass | 401.25 |
| IUPAC Name | [(2S,4R)-1-benzyl-4-[tert-butyl(dimethyl)silyl]oxypyrrolidin-2-yl]-(3-methylimidazol-4-yl)methanol |
| SMILES | Cn1cncc1C(O)[C@@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C22H35N3O2Si/c1-22(2,3)28(5,6)27-18-12-19(21(26)20-13-23-16-24(20)4)25(15-18)14-17-10-8-7-9-11-17/h7-11,13,16,18-19,21,26H,12,14-15H2,1-6H3/t18-,19+,21?/m1/s1 |
| InChIKey | OBGRPSPDNQWKLG-QSJYAPKHSA-N |
| XLogP | 4.12 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|