C30H33NO5S — CID 54141383
3-[cyclopropyl-[3-(quinolin-2-ylsulfonylmethyl)phenyl]methyl]-5,5-dipropyloxolane-2,4-dione (PubChem CID 54141383) has the molecular formula C30H33NO5S and a molecular weight of 519.66 g/mol. Its IUPAC name is 3-[cyclopropyl-[3-(quinolin-2-ylsulfonylmethyl)phenyl]methyl]-5,5-dipropyloxolane-2,4-dione.
| Compound Name | 3-[cyclopropyl-[3-(quinolin-2-ylsulfonylmethyl)phenyl]methyl]-5,5-dipropyloxolane-2,4-dione |
|---|---|
| PubChem CID | 54141383 |
| Molecular Formula | C30H33NO5S |
| Molecular Weight | 519.66 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 3-[cyclopropyl-[3-(quinolin-2-ylsulfonylmethyl)phenyl]methyl]-5,5-dipropyloxolane-2,4-dione |
| SMILES | CCCC1(CCC)OC(=O)C(C(c2cccc(CS(=O)(=O)c3ccc4ccccc4n3)c2)C2CC2)C1=O |
| InChI | InChI=1S/C30H33NO5S/c1-3-16-30(17-4-2)28(32)27(29(33)36-30)26(22-12-13-22)23-10-7-8-20(18-23)19-37(34,35)25-15-14-21-9-5-6-11-24(21)31-25/h5-11,14-15,18,22,26-27H,3-4,12-13,16-17,19H2,1-2H3 |
| InChIKey | OBISAWCOIUUMMS-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 90.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.66 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|