C17H12Br3N3O3 — CID 54141451
1-(2,3-dioxo-4,5-dihydro-1H-1-benzazepin-5-yl)-3-(2,3,4-tribromophenyl)urea (PubChem CID 54141451) has the molecular formula C17H12Br3N3O3 and a molecular weight of 546.01 g/mol. Its IUPAC name is 1-(2,3-dioxo-4,5-dihydro-1H-1-benzazepin-5-yl)-3-(2,3,4-tribromophenyl)urea.
| Compound Name | 1-(2,3-dioxo-4,5-dihydro-1H-1-benzazepin-5-yl)-3-(2,3,4-tribromophenyl)urea |
|---|---|
| PubChem CID | 54141451 |
| Molecular Formula | C17H12Br3N3O3 |
| Molecular Weight | 546.01 g/mol |
| Exact Mass | 542.84 |
| IUPAC Name | 1-(2,3-dioxo-4,5-dihydro-1H-1-benzazepin-5-yl)-3-(2,3,4-tribromophenyl)urea |
| SMILES | O=C(Nc1ccc(Br)c(Br)c1Br)NC1CC(=O)C(=O)Nc2ccccc21 |
| InChI | InChI=1S/C17H12Br3N3O3/c18-9-5-6-11(15(20)14(9)19)22-17(26)23-12-7-13(24)16(25)21-10-4-2-1-3-8(10)12/h1-6,12H,7H2,(H,21,25)(H2,22,23,26) |
| InChIKey | OBJVGOOFYDTYNB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.01 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|