C12H20N4O2 — CID 54141487
3-[2-[(pyridin-2-ylmethylamino)methylamino]ethylamino]propanoic acid (PubChem CID 54141487) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is 3-[2-[(pyridin-2-ylmethylamino)methylamino]ethylamino]propanoic acid.
| Compound Name | 3-[2-[(pyridin-2-ylmethylamino)methylamino]ethylamino]propanoic acid |
|---|---|
| PubChem CID | 54141487 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 3-[2-[(pyridin-2-ylmethylamino)methylamino]ethylamino]propanoic acid |
| SMILES | O=C(O)CCNCCNCNCc1ccccn1 |
| InChI | InChI=1S/C12H20N4O2/c17-12(18)4-6-13-7-8-14-10-15-9-11-3-1-2-5-16-11/h1-3,5,13-15H,4,6-10H2,(H,17,18) |
| InChIKey | OBKHDPJIKUYGPX-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 86.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|