C15H15NO3S — CID 54141547
1-[2-(4-methoxyphenyl)ethenyl]-4-(sulfinoamino)benzene (PubChem CID 54141547) has the molecular formula C15H15NO3S and a molecular weight of 289.36 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)ethenyl]-4-(sulfinoamino)benzene.
| Compound Name | 1-[2-(4-methoxyphenyl)ethenyl]-4-(sulfinoamino)benzene |
|---|---|
| PubChem CID | 54141547 |
| Molecular Formula | C15H15NO3S |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.08 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)ethenyl]-4-(sulfinoamino)benzene |
| SMILES | COc1ccc(C=Cc2ccc(NS(=O)O)cc2)cc1 |
| InChI | InChI=1S/C15H15NO3S/c1-19-15-10-6-13(7-11-15)3-2-12-4-8-14(9-5-12)16-20(17)18/h2-11,16H,1H3,(H,17,18) |
| InChIKey | OHSRBRHQMFGTON-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|