C32H46O5 — CID 541417
[2,6,13,17,17-pentamethyl-6-(4-methylpent-3-enyl)-4,8-dioxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl] acetate (PubChem CID 541417) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is [2,6,13,17,17-pentamethyl-6-(4-methylpent-3-enyl)-4,8-dioxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl] acetate.
| Compound Name | [2,6,13,17,17-pentamethyl-6-(4-methylpent-3-enyl)-4,8-dioxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl] acetate |
|---|---|
| PubChem CID | 541417 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | [2,6,13,17,17-pentamethyl-6-(4-methylpent-3-enyl)-4,8-dioxo-7-oxapentacyclo[10.8.0.02,9.05,9.013,18]icos-11-en-16-yl] acetate |
| SMILES | CC(=O)OC1CCC2(C)C3=CCC45C(=O)OC(C)(CCC=C(C)C)C4C(=O)CC5(C)C3CCC2C1(C)C |
| InChI | InChI=1S/C32H46O5/c1-19(2)10-9-15-31(8)26-23(34)18-30(7)22-11-12-24-28(4,5)25(36-20(3)33)14-16-29(24,6)21(22)13-17-32(26,30)27(35)37-31/h10,13,22,24-26H,9,11-12,14-18H2,1-8H3 |
| InChIKey | QRSBJVOULFMDFG-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|