About 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide
3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide (PubChem CID 54142085) has the molecular formula C16H15N5
and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide.
Molecular Properties
| Compound Name | 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide |
| PubChem CID | 54142085 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(-c2ccc3cc[nH]c3c2)c1/C(N)=N/[H] |
| InChI | InChI=1S/C16H15N5/c17-15(18)12-3-1-2-11(14(12)16(19)20)10-5-4-9-6-7-21-13(9)8-10/h1-8,21H,(H3,17,18)(H3,19,20) |
| InChIKey | OBUJEQIRHHJTMF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 115.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide?
The IUPAC name of 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide (CID 54142085) is 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide.
What is the SMILES notation for 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide?
The canonical SMILES for 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide is [H]/N=C(\N)c1cccc(-c2ccc3cc[nH]c3c2)c1/C(N)=N/[H].
What is the InChIKey of 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide?
The InChIKey is OBUJEQIRHHJTMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5/c17-15(18)12-3-1-2-11(14(12)16(19)20)10-5-4-9-6-7-21-13(9)8-10/h1-8,21H,(H3,17,18)(H3,19,20).
What are the key properties of 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide?
3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide has a molecular weight of 277.33 g/mol, XLogP of 2.40, 3 rotatable bonds, 5 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1H-indol-6-yl)benzene-1,2-dicarboximidamide is sourced from PubChem (CID 54142085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).