C26H31N5O2S — CID 54143177
6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]sulfonyl-4-piperidin-1-ylquinazoline (PubChem CID 54143177) has the molecular formula C26H31N5O2S and a molecular weight of 477.63 g/mol. Its IUPAC name is 6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]sulfonyl-4-piperidin-1-ylquinazoline.
| Compound Name | 6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]sulfonyl-4-piperidin-1-ylquinazoline |
|---|---|
| PubChem CID | 54143177 |
| Molecular Formula | C26H31N5O2S |
| Molecular Weight | 477.63 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | 6-[4-(3-phenylprop-2-enyl)piperazin-1-yl]sulfonyl-4-piperidin-1-ylquinazoline |
| SMILES | O=S(=O)(c1ccc2ncnc(N3CCCCC3)c2c1)N1CCN(CC=Cc2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N5O2S/c32-34(33,31-18-16-29(17-19-31)13-7-10-22-8-3-1-4-9-22)23-11-12-25-24(20-23)26(28-21-27-25)30-14-5-2-6-15-30/h1,3-4,7-12,20-21H,2,5-6,13-19H2 |
| InChIKey | OCMUZKOKWLRAFT-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 69.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.63 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |