C21H41N2+ — CID 54143369
3-octadec-9-en-2-yl-4,5-dihydro-1H-imidazol-3-ium (PubChem CID 54143369) has the molecular formula C21H41N2+ and a molecular weight of 321.57 g/mol. Its IUPAC name is 3-octadec-9-en-2-yl-4,5-dihydro-1H-imidazol-3-ium.
| Compound Name | 3-octadec-9-en-2-yl-4,5-dihydro-1H-imidazol-3-ium |
|---|---|
| PubChem CID | 54143369 |
| Molecular Formula | C21H41N2+ |
| Molecular Weight | 321.57 g/mol |
| Exact Mass | 321.33 |
| IUPAC Name | 3-octadec-9-en-2-yl-4,5-dihydro-1H-imidazol-3-ium |
| SMILES | CCCCCCCCC=CCCCCCCC(C)[N+]1=CNCC1 |
| InChI | InChI=1S/C21H40N2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(2)23-19-18-22-20-23/h10-11,20-21H,3-9,12-19H2,1-2H3/p+1 |
| InChIKey | OCQMJADXZKRFPF-UHFFFAOYSA-O |
| XLogP | 5.67 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.57 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|