C44H54F2O4 — CID 541434
[4,8-didecoxy-5-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone (PubChem CID 541434) has the molecular formula C44H54F2O4 and a molecular weight of 684.91 g/mol. Its IUPAC name is [4,8-didecoxy-5-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone.
| Compound Name | [4,8-didecoxy-5-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone |
|---|---|
| PubChem CID | 541434 |
| Molecular Formula | C44H54F2O4 |
| Molecular Weight | 684.91 g/mol |
| Exact Mass | 684.40 |
| IUPAC Name | [4,8-didecoxy-5-(4-fluorobenzoyl)naphthalen-1-yl]-(4-fluorophenyl)methanone |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)c2ccc(F)cc2)c2c(OCCCCCCCCCC)ccc(C(=O)c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C44H54F2O4/c1-3-5-7-9-11-13-15-17-31-49-39-29-27-38(44(48)34-21-25-36(46)26-22-34)42-40(50-32-18-16-14-12-10-8-6-4-2)30-28-37(41(39)42)43(47)33-19-23-35(45)24-20-33/h19-30H,3-18,31-32H2,1-2H3 |
| InChIKey | NVMVQSCKUVHMSS-UHFFFAOYSA-N |
| XLogP | 12.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.91 |
| LogP ≤ 5 | 12.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|