About 5,5-dimethoxy-2,4-dimethylpent-2-enal
5,5-dimethoxy-2,4-dimethylpent-2-enal (PubChem CID 54143476) has the molecular formula C9H16O3
and a molecular weight of 172.22 g/mol. Its IUPAC name is 5,5-dimethoxy-2,4-dimethylpent-2-enal.
Molecular Properties
| Compound Name | 5,5-dimethoxy-2,4-dimethylpent-2-enal |
| PubChem CID | 54143476 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 5,5-dimethoxy-2,4-dimethylpent-2-enal |
| SMILES | COC(OC)C(C)C=C(C)C=O |
| InChI | InChI=1S/C9H16O3/c1-7(6-10)5-8(2)9(11-3)12-4/h5-6,8-9H,1-4H3 |
| InChIKey | BEQZNGQRAOBHJT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethoxy-2,4-dimethylpent-2-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethoxy-2,4-dimethylpent-2-enal?
The IUPAC name of 5,5-dimethoxy-2,4-dimethylpent-2-enal (CID 54143476) is 5,5-dimethoxy-2,4-dimethylpent-2-enal.
What is the SMILES notation for 5,5-dimethoxy-2,4-dimethylpent-2-enal?
The canonical SMILES for 5,5-dimethoxy-2,4-dimethylpent-2-enal is COC(OC)C(C)C=C(C)C=O.
What is the InChIKey of 5,5-dimethoxy-2,4-dimethylpent-2-enal?
The InChIKey is BEQZNGQRAOBHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O3/c1-7(6-10)5-8(2)9(11-3)12-4/h5-6,8-9H,1-4H3.
What are the key properties of 5,5-dimethoxy-2,4-dimethylpent-2-enal?
5,5-dimethoxy-2,4-dimethylpent-2-enal has a molecular weight of 172.22 g/mol, XLogP of 1.39, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethoxy-2,4-dimethylpent-2-enal is sourced from PubChem (CID 54143476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).