C26H30FNO5 — CID 54144006
[3-[1-[5-[2-(4-fluorophenyl)ethyl]-2,4-dioxo-6-propyloxan-3-yl]propyl]phenyl]carbamic acid (PubChem CID 54144006) has the molecular formula C26H30FNO5 and a molecular weight of 455.53 g/mol. Its IUPAC name is [3-[1-[5-[2-(4-fluorophenyl)ethyl]-2,4-dioxo-6-propyloxan-3-yl]propyl]phenyl]carbamic acid.
| Compound Name | [3-[1-[5-[2-(4-fluorophenyl)ethyl]-2,4-dioxo-6-propyloxan-3-yl]propyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 54144006 |
| Molecular Formula | C26H30FNO5 |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | [3-[1-[5-[2-(4-fluorophenyl)ethyl]-2,4-dioxo-6-propyloxan-3-yl]propyl]phenyl]carbamic acid |
| SMILES | CCCC1OC(=O)C(C(CC)c2cccc(NC(=O)O)c2)C(=O)C1CCc1ccc(F)cc1 |
| InChI | InChI=1S/C26H30FNO5/c1-3-6-22-21(14-11-16-9-12-18(27)13-10-16)24(29)23(25(30)33-22)20(4-2)17-7-5-8-19(15-17)28-26(31)32/h5,7-10,12-13,15,20-23,28H,3-4,6,11,14H2,1-2H3,(H,31,32) |
| InChIKey | ODBOKMMPIKDVMS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|