About 2,2-dimethylbutane;2,2,3,3-tetramethylbutane
2,2-dimethylbutane;2,2,3,3-tetramethylbutane (PubChem CID 54144255) has the molecular formula C14H32
and a molecular weight of 200.41 g/mol. Its IUPAC name is 2,2-dimethylbutane;2,2,3,3-tetramethylbutane.
Analyze 2,2-dimethylbutane;2,2,3,3-tetramethylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylbutane;2,2,3,3-tetramethylbutane?
The IUPAC name of 2,2-dimethylbutane;2,2,3,3-tetramethylbutane (CID 54144255) is 2,2-dimethylbutane;2,2,3,3-tetramethylbutane.
What is the SMILES notation for 2,2-dimethylbutane;2,2,3,3-tetramethylbutane?
The canonical SMILES for 2,2-dimethylbutane;2,2,3,3-tetramethylbutane is CC(C)(C)C(C)(C)C.CCC(C)(C)C.
What is the InChIKey of 2,2-dimethylbutane;2,2,3,3-tetramethylbutane?
The InChIKey is ODFVOSYJXBDZPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18.C6H14/c1-7(2,3)8(4,5)6;1-5-6(2,3)4/h1-6H3;5H2,1-4H3.
What are the key properties of 2,2-dimethylbutane;2,2,3,3-tetramethylbutane?
2,2-dimethylbutane;2,2,3,3-tetramethylbutane has a molecular weight of 200.41 g/mol, XLogP of 5.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylbutane;2,2,3,3-tetramethylbutane is sourced from PubChem (CID 54144255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).