About 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde
5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde (PubChem CID 541443) has the molecular formula C4H4N2O4
and a molecular weight of 144.09 g/mol. Its IUPAC name is 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde.
Molecular Properties
| Compound Name | 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde |
| PubChem CID | 541443 |
| Molecular Formula | C4H4N2O4 |
| Molecular Weight | 144.09 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde |
| SMILES | O=CN1C(=O)NC(=O)C1O |
| InChI | InChI=1S/C4H4N2O4/c7-1-6-3(9)2(8)5-4(6)10/h1,3,9H,(H,5,8,10) |
| InChIKey | LJFFFJAFJCDBRH-UHFFFAOYSA-N |
| XLogP | -1.99 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.09 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde?
The IUPAC name of 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde (CID 541443) is 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde.
What is the SMILES notation for 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde?
The canonical SMILES for 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde is O=CN1C(=O)NC(=O)C1O.
What is the InChIKey of 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde?
The InChIKey is LJFFFJAFJCDBRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O4/c7-1-6-3(9)2(8)5-4(6)10/h1,3,9H,(H,5,8,10).
What are the key properties of 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde?
5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde has a molecular weight of 144.09 g/mol, XLogP of -1.99, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2,4-dioxoimidazolidine-1-carbaldehyde is sourced from PubChem (CID 541443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).