C25H28N2O4 — CID 54144306
trans-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-2,2-dimethyl-3-(2-methylpropoxyiminomethyl)cyclopropane-1-carboxylate (PubChem CID 54144306) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is trans-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-2,2-dimethyl-3-(2-methylpropoxyiminomethyl)cyclopropane-1-carboxylate.
| Compound Name | trans-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-2,2-dimethyl-3-(2-methylpropoxyiminomethyl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 54144306 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | trans-[cyano-(3-phenoxyphenyl)methyl] (1R,3S)-2,2-dimethyl-3-(2-methylpropoxyiminomethyl)cyclopropane-1-carboxylate |
| SMILES | CC(C)CON=C[C@H]1[C@@H](C(=O)OC(C#N)c2cccc(Oc3ccccc3)c2)C1(C)C |
| InChI | InChI=1S/C25H28N2O4/c1-17(2)16-29-27-15-21-23(25(21,3)4)24(28)31-22(14-26)18-9-8-12-20(13-18)30-19-10-6-5-7-11-19/h5-13,15,17,21-23H,16H2,1-4H3/t21-,22?,23-/m0/s1 |
| InChIKey | ODGYNCVHSNBIMB-LIMDNCRJSA-N |
| XLogP | 5.52 |
| TPSA | 80.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|