C9H3Cl4NO2 — CID 54144640
4,5,6,7-tetrachloro-3-hydroxy-1H-quinolin-2-one (PubChem CID 54144640) has the molecular formula C9H3Cl4NO2 and a molecular weight of 298.94 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3-hydroxy-1H-quinolin-2-one.
| Compound Name | 4,5,6,7-tetrachloro-3-hydroxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54144640 |
| Molecular Formula | C9H3Cl4NO2 |
| Molecular Weight | 298.94 g/mol |
| Exact Mass | 296.89 |
| IUPAC Name | 4,5,6,7-tetrachloro-3-hydroxy-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2cc(Cl)c(Cl)c(Cl)c2c(Cl)c1O |
| InChI | InChI=1S/C9H3Cl4NO2/c10-2-1-3-4(6(12)5(2)11)7(13)8(15)9(16)14-3/h1,15H,(H,14,16) |
| InChIKey | ODMGSWOQEZDOGI-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 53.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.94 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|