C14H14Cl2N4O4 — CID 54144651
3-(butylaminomethylidene)-7,8-dichloro-6-nitro-1,5-dihydro-1,5-benzodiazepine-2,4-dione (PubChem CID 54144651) has the molecular formula C14H14Cl2N4O4 and a molecular weight of 373.20 g/mol. Its IUPAC name is 3-(butylaminomethylidene)-7,8-dichloro-6-nitro-1,5-dihydro-1,5-benzodiazepine-2,4-dione.
| Compound Name | 3-(butylaminomethylidene)-7,8-dichloro-6-nitro-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 54144651 |
| Molecular Formula | C14H14Cl2N4O4 |
| Molecular Weight | 373.20 g/mol |
| Exact Mass | 372.04 |
| IUPAC Name | 3-(butylaminomethylidene)-7,8-dichloro-6-nitro-1,5-dihydro-1,5-benzodiazepine-2,4-dione |
| SMILES | CCCCNC=C1C(=O)Nc2cc(Cl)c(Cl)c([N+](=O)[O-])c2NC1=O |
| InChI | InChI=1S/C14H14Cl2N4O4/c1-2-3-4-17-6-7-13(21)18-9-5-8(15)10(16)12(20(23)24)11(9)19-14(7)22/h5-6,17H,2-4H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | ODMPFMPMFCLXKU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.20 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|