C38H34BrN5O3 — CID 54144910
4-(bromomethyl)-6-methyl-1-(3-methylphenyl)pyridin-2-one;4-[[5-(4-isocyanophenoxy)imidazol-1-yl]methyl]-5-methyl-1-(3-methylphenyl)pyridin-2-one (PubChem CID 54144910) has the molecular formula C38H34BrN5O3 and a molecular weight of 688.63 g/mol. Its IUPAC name is 4-(bromomethyl)-6-methyl-1-(3-methylphenyl)pyridin-2-one;4-[[5-(4-isocyanophenoxy)imidazol-1-yl]methyl]-5-methyl-1-(3-methylphenyl)pyridin-2-one.
| Compound Name | 4-(bromomethyl)-6-methyl-1-(3-methylphenyl)pyridin-2-one;4-[[5-(4-isocyanophenoxy)imidazol-1-yl]methyl]-5-methyl-1-(3-methylphenyl)pyridin-2-one |
|---|---|
| PubChem CID | 54144910 |
| Molecular Formula | C38H34BrN5O3 |
| Molecular Weight | 688.63 g/mol |
| Exact Mass | 687.18 |
| IUPAC Name | 4-(bromomethyl)-6-methyl-1-(3-methylphenyl)pyridin-2-one;4-[[5-(4-isocyanophenoxy)imidazol-1-yl]methyl]-5-methyl-1-(3-methylphenyl)pyridin-2-one |
| SMILES | Cc1cccc(-n2c(C)cc(CBr)cc2=O)c1.[C-]#[N+]c1ccc(Oc2cncn2Cc2cc(=O)n(-c3cccc(C)c3)cc2C)cc1 |
| InChI | InChI=1S/C24H20N4O2.C14H14BrNO/c1-17-5-4-6-21(11-17)28-14-18(2)19(12-23(28)29)15-27-16-26-13-24(27)30-22-9-7-20(25-3)8-10-22;1-10-4-3-5-13(6-10)16-11(2)7-12(9-15)8-14(16)17/h4-14,16H,15H2,1-2H3;3-8H,9H2,1-2H3 |
| InChIKey | ODRGEJZKBHHDSD-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 75.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.63 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|