About 1-hexan-3-ylimidazole
1-hexan-3-ylimidazole (PubChem CID 54145075) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-hexan-3-ylimidazole.
Molecular Properties
| Compound Name | 1-hexan-3-ylimidazole |
| PubChem CID | 54145075 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 1-hexan-3-ylimidazole |
| SMILES | CCCC(CC)n1ccnc1 |
| InChI | InChI=1S/C9H16N2/c1-3-5-9(4-2)11-7-6-10-8-11/h6-9H,3-5H2,1-2H3 |
| InChIKey | GHSLHDFZMAGPGE-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-hexan-3-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hexan-3-ylimidazole?
The IUPAC name of 1-hexan-3-ylimidazole (CID 54145075) is 1-hexan-3-ylimidazole.
What is the SMILES notation for 1-hexan-3-ylimidazole?
The canonical SMILES for 1-hexan-3-ylimidazole is CCCC(CC)n1ccnc1.
What is the InChIKey of 1-hexan-3-ylimidazole?
The InChIKey is GHSLHDFZMAGPGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-5-9(4-2)11-7-6-10-8-11/h6-9H,3-5H2,1-2H3.
What are the key properties of 1-hexan-3-ylimidazole?
1-hexan-3-ylimidazole has a molecular weight of 152.24 g/mol, XLogP of 2.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hexan-3-ylimidazole is sourced from PubChem (CID 54145075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).