C18H22N2O2S — CID 54145108
1-but-2-enyl-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione (PubChem CID 54145108) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 1-but-2-enyl-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione.
| Compound Name | 1-but-2-enyl-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 54145108 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 1-but-2-enyl-6-(3,5-dimethylphenyl)sulfanyl-5-ethylpyrimidine-2,4-dione |
| SMILES | CC=CCn1c(Sc2cc(C)cc(C)c2)c(CC)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N2O2S/c1-5-7-8-20-17(15(6-2)16(21)19-18(20)22)23-14-10-12(3)9-13(4)11-14/h5,7,9-11H,6,8H2,1-4H3,(H,19,21,22) |
| InChIKey | ODUVXNPDPPBDPD-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|