C6F12O2 — CID 54145359
2,2,3,3,5,6-hexafluoro-5,6-bis(trifluoromethyl)-1,4-dioxane (PubChem CID 54145359) has the molecular formula C6F12O2 and a molecular weight of 332.04 g/mol. Its IUPAC name is 2,2,3,3,5,6-hexafluoro-5,6-bis(trifluoromethyl)-1,4-dioxane.
| Compound Name | 2,2,3,3,5,6-hexafluoro-5,6-bis(trifluoromethyl)-1,4-dioxane |
|---|---|
| PubChem CID | 54145359 |
| Molecular Formula | C6F12O2 |
| Molecular Weight | 332.04 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | 2,2,3,3,5,6-hexafluoro-5,6-bis(trifluoromethyl)-1,4-dioxane |
| SMILES | FC(F)(F)C1(F)OC(F)(F)C(F)(F)OC1(F)C(F)(F)F |
| InChI | InChI=1S/C6F12O2/c7-1(3(9,10)11)2(8,4(12,13)14)20-6(17,18)5(15,16)19-1 |
| InChIKey | ODZPWRLCBLLODC-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.04 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|