C18H17N3O3 — CID 5414551
N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-1H-indole-3-carboxamide (PubChem CID 5414551) has the molecular formula C18H17N3O3 and a molecular weight of 323.35 g/mol. Its IUPAC name is N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-1H-indole-3-carboxamide.
| Compound Name | N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 5414551 |
| Molecular Formula | C18H17N3O3 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | N-[(Z)-(2,5-dimethoxyphenyl)methylideneamino]-1H-indole-3-carboxamide |
| SMILES | COc1ccc(OC)c(/C=N\NC(=O)c2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C18H17N3O3/c1-23-13-7-8-17(24-2)12(9-13)10-20-21-18(22)15-11-19-16-6-4-3-5-14(15)16/h3-11,19H,1-2H3,(H,21,22)/b20-10- |
| InChIKey | YGJQWQIGOUIORY-JMIUGGIZSA-N |
| XLogP | 2.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|