C26H26N2O4 — CID 54145703
5,11-bis(hex-5-enyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone (PubChem CID 54145703) has the molecular formula C26H26N2O4 and a molecular weight of 430.50 g/mol. Its IUPAC name is 5,11-bis(hex-5-enyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone.
| Compound Name | 5,11-bis(hex-5-enyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
|---|---|
| PubChem CID | 54145703 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 5,11-bis(hex-5-enyl)-5,11-diazatetracyclo[7.3.2.23,7.02,8]hexadeca-1(13),2,7,9(14),15-pentaene-4,6,10,12-tetrone |
| SMILES | C=CCCCCn1c(=O)c2ccc(c1=O)c1c3ccc(c(=O)n(CCCCC=C)c3=O)c21 |
| InChI | InChI=1S/C26H26N2O4/c1-3-5-7-9-15-27-23(29)17-11-12-18(24(27)30)22-20-14-13-19(21(17)22)25(31)28(26(20)32)16-10-8-6-4-2/h3-4,11-14H,1-2,5-10,15-16H2 |
| InChIKey | OEFMZEGMLLUQQD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|