C13H16N2OS — CID 5414581
(1R,2R,4S)-N-[(Z)-thiophen-2-ylmethylideneamino]bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 5414581) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is (1R,2R,4S)-N-[(Z)-thiophen-2-ylmethylideneamino]bicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,2R,4S)-N-[(Z)-thiophen-2-ylmethylideneamino]bicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 5414581 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | (1R,2R,4S)-N-[(Z)-thiophen-2-ylmethylideneamino]bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | O=C(N/N=C\c1cccs1)[C@@H]1C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C13H16N2OS/c16-13(12-7-9-3-4-10(12)6-9)15-14-8-11-2-1-5-17-11/h1-2,5,8-10,12H,3-4,6-7H2,(H,15,16)/b14-8-/t9-,10+,12+/m0/s1 |
| InChIKey | DJWDETGXNBGOHX-YIUJMVDFSA-N |
| XLogP | 2.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|