About 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene
5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene (PubChem CID 54145827) has the molecular formula C11H14
and a molecular weight of 146.23 g/mol. Its IUPAC name is 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene.
Molecular Properties
| Compound Name | 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene |
| PubChem CID | 54145827 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene |
| SMILES | C=CC=CC1CC2C=CC1C2 |
| InChI | InChI=1S/C11H14/c1-2-3-4-10-7-9-5-6-11(10)8-9/h2-6,9-11H,1,7-8H2 |
| InChIKey | OEHSOYQZDSWJKX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene?
The IUPAC name of 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene (CID 54145827) is 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene.
What is the SMILES notation for 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene?
The canonical SMILES for 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene is C=CC=CC1CC2C=CC1C2.
What is the InChIKey of 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene?
The InChIKey is OEHSOYQZDSWJKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14/c1-2-3-4-10-7-9-5-6-11(10)8-9/h2-6,9-11H,1,7-8H2.
What are the key properties of 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene?
5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene has a molecular weight of 146.23 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-buta-1,3-dienylbicyclo[2.2.1]hept-2-ene is sourced from PubChem (CID 54145827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).