C34H58N6O6 — CID 54145976
2,6-bis[2-hydroxy-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone (PubChem CID 54145976) has the molecular formula C34H58N6O6 and a molecular weight of 646.87 g/mol. Its IUPAC name is 2,6-bis[2-hydroxy-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone.
| Compound Name | 2,6-bis[2-hydroxy-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
|---|---|
| PubChem CID | 54145976 |
| Molecular Formula | C34H58N6O6 |
| Molecular Weight | 646.87 g/mol |
| Exact Mass | 646.44 |
| IUPAC Name | 2,6-bis[2-hydroxy-3-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]propyl]-3a,4,4a,7a,8,8a-hexahydropyrrolo[3,4-f]isoindole-1,3,5,7-tetrone |
| SMILES | CC1(C)CC(NCC(O)CN2C(=O)C3CC4C(=O)N(CC(O)CNC5CC(C)(C)NC(C)(C)C5)C(=O)C4CC3C2=O)CC(C)(C)N1 |
| InChI | InChI=1S/C34H58N6O6/c1-31(2)11-19(12-32(3,4)37-31)35-15-21(41)17-39-27(43)23-9-25-26(10-24(23)28(39)44)30(46)40(29(25)45)18-22(42)16-36-20-13-33(5,6)38-34(7,8)14-20/h19-26,35-38,41-42H,9-18H2,1-8H3 |
| InChIKey | SHQISSMCZRTTPC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 163.34 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.87 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|