C20H36O — CID 54145997
2,6,11,15-tetramethylhexadeca-2,10,14-trien-8-ol (PubChem CID 54145997) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is 2,6,11,15-tetramethylhexadeca-2,10,14-trien-8-ol.
| Compound Name | 2,6,11,15-tetramethylhexadeca-2,10,14-trien-8-ol |
|---|---|
| PubChem CID | 54145997 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | 2,6,11,15-tetramethylhexadeca-2,10,14-trien-8-ol |
| SMILES | CC(C)=CCCC(C)=CCC(O)CC(C)CCC=C(C)C |
| InChI | InChI=1S/C20H36O/c1-16(2)9-7-11-18(5)13-14-20(21)15-19(6)12-8-10-17(3)4/h9-10,13,19-21H,7-8,11-12,14-15H2,1-6H3 |
| InChIKey | OEKPJXQLBVHEKR-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|