C16H14N2O2 — CID 54146126
5-but-2-enylpyrido[2,3-b][1,4]benzoxazepin-6-one (PubChem CID 54146126) has the molecular formula C16H14N2O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-but-2-enylpyrido[2,3-b][1,4]benzoxazepin-6-one.
| Compound Name | 5-but-2-enylpyrido[2,3-b][1,4]benzoxazepin-6-one |
|---|---|
| PubChem CID | 54146126 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 5-but-2-enylpyrido[2,3-b][1,4]benzoxazepin-6-one |
| SMILES | CC=CCN1C(=O)c2ccccc2Oc2ncccc21 |
| InChI | InChI=1S/C16H14N2O2/c1-2-3-11-18-13-8-6-10-17-15(13)20-14-9-5-4-7-12(14)16(18)19/h2-10H,11H2,1H3 |
| InChIKey | OEMXDSFSCPQHFB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|