About 2-pent-1-enylguanidine
2-pent-1-enylguanidine (PubChem CID 54146156) has the molecular formula C6H13N3
and a molecular weight of 127.19 g/mol. Its IUPAC name is 2-pent-1-enylguanidine.
Molecular Properties
| Compound Name | 2-pent-1-enylguanidine |
| PubChem CID | 54146156 |
| Molecular Formula | C6H13N3 |
| Molecular Weight | 127.19 g/mol |
| Exact Mass | 127.11 |
| IUPAC Name | 2-pent-1-enylguanidine |
| SMILES | CCCC=CN=C(N)N |
| InChI | InChI=1S/C6H13N3/c1-2-3-4-5-9-6(7)8/h4-5H,2-3H2,1H3,(H4,7,8,9) |
| InChIKey | OENOBKVZDPLPOJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.19 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-pent-1-enylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pent-1-enylguanidine?
The IUPAC name of 2-pent-1-enylguanidine (CID 54146156) is 2-pent-1-enylguanidine.
What is the SMILES notation for 2-pent-1-enylguanidine?
The canonical SMILES for 2-pent-1-enylguanidine is CCCC=CN=C(N)N.
What is the InChIKey of 2-pent-1-enylguanidine?
The InChIKey is OENOBKVZDPLPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N3/c1-2-3-4-5-9-6(7)8/h4-5H,2-3H2,1H3,(H4,7,8,9).
What are the key properties of 2-pent-1-enylguanidine?
2-pent-1-enylguanidine has a molecular weight of 127.19 g/mol, XLogP of 0.57, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pent-1-enylguanidine is sourced from PubChem (CID 54146156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).