About [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid
[(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid (PubChem CID 54146158) has the molecular formula C13H28O6P2
and a molecular weight of 342.31 g/mol. Its IUPAC name is [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid.
Molecular Properties
| Compound Name | [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid |
| PubChem CID | 54146158 |
| Molecular Formula | C13H28O6P2 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid |
| SMILES | CC(C)=CCC[C@H](C)CCCCC(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C13H28O6P2/c1-11(2)7-6-9-12(3)8-4-5-10-13(20(14,15)16)21(17,18)19/h7,12-13H,4-6,8-10H2,1-3H3,(H2,14,15,16)(H2,17,18,19)/t12-/m1/s1 |
| InChIKey | OENOUDYHDZJNJE-GFCCVEGCSA-N |
| XLogP | 3.61 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid?
The IUPAC name of [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid (CID 54146158) is [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid.
What is the SMILES notation for [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid?
The canonical SMILES for [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid is CC(C)=CCC[C@H](C)CCCCC(P(=O)(O)O)P(=O)(O)O.
What is the InChIKey of [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid?
The InChIKey is OENOUDYHDZJNJE-GFCCVEGCSA-N. The full InChI is InChI=1S/C13H28O6P2/c1-11(2)7-6-9-12(3)8-4-5-10-13(20(14,15)16)21(17,18)19/h7,12-13H,4-6,8-10H2,1-3H3,(H2,14,15,16)(H2,17,18,19)/t12-/m1/s1.
What are the key properties of [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid?
[(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid has a molecular weight of 342.31 g/mol, XLogP of 3.61, 10 rotatable bonds, 4 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(6R)-6,10-dimethyl-1-phosphonoundec-9-enyl]phosphonic acid is sourced from PubChem (CID 54146158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).