About 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione
4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione (PubChem CID 54146336) has the molecular formula C24H25N3O3S
and a molecular weight of 435.55 g/mol. Its IUPAC name is 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione.
Molecular Properties
| Compound Name | 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione |
| PubChem CID | 54146336 |
| Molecular Formula | C24H25N3O3S |
| Molecular Weight | 435.55 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione |
| SMILES | Cc1ccc(-c2nc(SCCCN3C(=O)COCC3=O)[nH]c2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O3S/c1-16-4-8-18(9-5-16)22-23(19-10-6-17(2)7-11-19)26-24(25-22)31-13-3-12-27-20(28)14-30-15-21(27)29/h4-11H,3,12-15H2,1-2H3,(H,25,26) |
| InChIKey | OEQLFTVPYNFMDP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 435.55 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione?
The IUPAC name of 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione (CID 54146336) is 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione.
What is the SMILES notation for 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione?
The canonical SMILES for 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione is Cc1ccc(-c2nc(SCCCN3C(=O)COCC3=O)[nH]c2-c2ccc(C)cc2)cc1.
What is the InChIKey of 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione?
The InChIKey is OEQLFTVPYNFMDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25N3O3S/c1-16-4-8-18(9-5-16)22-23(19-10-6-17(2)7-11-19)26-24(25-22)31-13-3-12-27-20(28)14-30-15-21(27)29/h4-11H,3,12-15H2,1-2H3,(H,25,26).
What are the key properties of 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione?
4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione has a molecular weight of 435.55 g/mol, XLogP of 4.23, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-[[4,5-bis(4-methylphenyl)-1H-imidazol-2-yl]sulfanyl]propyl]morpholine-3,5-dione is sourced from PubChem (CID 54146336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).